C27H37N3O7Si — CID 164848352
(4-nitrobenzoyl) (4S,5R,6S)-3-[(E)-3-aminoprop-1-enyl]-4,6-dimethyl-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 164848352) has the molecular formula C27H37N3O7Si and a molecular weight of 543.69 g/mol. Its IUPAC name is (4-nitrobenzoyl) (4S,5R,6S)-3-[(E)-3-aminoprop-1-enyl]-4,6-dimethyl-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrobenzoyl) (4S,5R,6S)-3-[(E)-3-aminoprop-1-enyl]-4,6-dimethyl-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 164848352 |
| Molecular Formula | C27H37N3O7Si |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | (4-nitrobenzoyl) (4S,5R,6S)-3-[(E)-3-aminoprop-1-enyl]-4,6-dimethyl-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)[C@@]1(C)C(=O)N2C(C(=O)OC(=O)c3ccc([N+](=O)[O-])cc3)=C(/C=C/CN)[C@H](C)[C@@H]21 |
| InChI | InChI=1S/C27H37N3O7Si/c1-7-38(8-2,9-3)37-18(5)27(6)23-17(4)21(11-10-16-28)22(29(23)26(27)33)25(32)36-24(31)19-12-14-20(15-13-19)30(34)35/h10-15,17-18,23H,7-9,16,28H2,1-6H3/b11-10+/t17-,18+,23+,27+/m0/s1 |
| InChIKey | KZDHVURNSUVVTA-ZXAZQPRLSA-N |
| XLogP | 4.32 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|