C35H24FN2OS+ — CID 164849420
2-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium (PubChem CID 164849420) has the molecular formula C35H24FN2OS+ and a molecular weight of 539.66 g/mol. Its IUPAC name is 2-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium.
| Compound Name | 2-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 164849420 |
| Molecular Formula | C35H24FN2OS+ |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-(6-dibenzothiophen-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-phenylimidazol-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)sc4ccccc45)c(F)ccc32)c1-c1n(-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C35H24FN2OS/c1-21-12-14-26-27-16-17-28(36)32(22-13-15-25-24-10-6-7-11-29(24)40-30(25)20-22)34(27)39-33(26)31(21)35-37(2)18-19-38(35)23-8-4-3-5-9-23/h3-20H,1-2H3/q+1 |
| InChIKey | UOVBSVRSJQTPJR-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|