C15H22ClN3O3 — CID 164855223
tert-butyl 2-chloro-8-(2-hydroxyethylamino)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (PubChem CID 164855223) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is tert-butyl 2-chloro-8-(2-hydroxyethylamino)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl 2-chloro-8-(2-hydroxyethylamino)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 164855223 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | tert-butyl 2-chloro-8-(2-hydroxyethylamino)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccc(Cl)nc2C(NCCO)C1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-15(2,3)22-14(21)19-8-10-4-5-12(16)18-13(10)11(9-19)17-6-7-20/h4-5,11,17,20H,6-9H2,1-3H3 |
| InChIKey | UTOMRMRVLOXTHY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|