C15H19ClN4O2 — CID 177223171
tert-butyl 3-[(6-chloropyrazolo[3,4-b]pyridin-2-yl)methyl]azetidine-1-carboxylate (PubChem CID 177223171) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is tert-butyl 3-[(6-chloropyrazolo[3,4-b]pyridin-2-yl)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-chloropyrazolo[3,4-b]pyridin-2-yl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 177223171 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | tert-butyl 3-[(6-chloropyrazolo[3,4-b]pyridin-2-yl)methyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Cn2cc3ccc(Cl)nc3n2)C1 |
| InChI | InChI=1S/C15H19ClN4O2/c1-15(2,3)22-14(21)19-6-10(7-19)8-20-9-11-4-5-12(16)17-13(11)18-20/h4-5,9-10H,6-8H2,1-3H3 |
| InChIKey | TVHAFMVSDZYEDZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|