C25H25N3O2 — CID 164856524
acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-[(Z)-2,5-diiminopent-3-enoxy]-6-methylpyridin-2-one (PubChem CID 164856524) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-[(Z)-2,5-diiminopent-3-enoxy]-6-methylpyridin-2-one.
| Compound Name | acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-[(Z)-2,5-diiminopent-3-enoxy]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 164856524 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | acetylene;1-[[4-(2-cyclopropylethynyl)phenyl]methyl]-4-[(Z)-2,5-diiminopent-3-enoxy]-6-methylpyridin-2-one |
| SMILES | C#C.[H]/N=C/C=C\C(COc1cc(C)n(Cc2ccc(C#CC3CC3)cc2)c(=O)c1)=N/[H] |
| InChI | InChI=1S/C23H23N3O2.C2H2/c1-17-13-22(28-16-21(25)3-2-12-24)14-23(27)26(17)15-20-10-8-19(9-11-20)7-6-18-4-5-18;1-2/h2-3,8-14,18,24-25H,4-5,15-16H2,1H3;1-2H/b3-2-,24-12+,25-21+; |
| InChIKey | RPNMPLGSQCORIU-BKVNSJJSSA-N |
| XLogP | 3.82 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|