C20H26N4O2 — CID 164857539
N'-amino-2-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-N-methyl-N-(2-methyl-5-prop-1-ynylphenyl)ethanimidamide (PubChem CID 164857539) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N'-amino-2-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-N-methyl-N-(2-methyl-5-prop-1-ynylphenyl)ethanimidamide.
| Compound Name | N'-amino-2-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-N-methyl-N-(2-methyl-5-prop-1-ynylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 164857539 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N'-amino-2-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-N-methyl-N-(2-methyl-5-prop-1-ynylphenyl)ethanimidamide |
| SMILES | CC#Cc1ccc(C)c(N(C)C(/C=N/CC2OCC3(CC3)CO2)=N/N)c1 |
| InChI | InChI=1S/C20H26N4O2/c1-4-5-16-7-6-15(2)17(10-16)24(3)18(23-21)11-22-12-19-25-13-20(8-9-20)14-26-19/h6-7,10-11,19H,8-9,12-14,21H2,1-3H3/b22-11+,23-18+ |
| InChIKey | UAQNFBDWGOQYFO-ZKNHDNAPSA-N |
| XLogP | 2.30 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|