C11H10BrN3O3S — CID 164858810
4-[(1R)-1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-2-methyl-1,3-thiazole (PubChem CID 164858810) has the molecular formula C11H10BrN3O3S and a molecular weight of 344.19 g/mol. Its IUPAC name is 4-[(1R)-1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(1R)-1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 164858810 |
| Molecular Formula | C11H10BrN3O3S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 4-[(1R)-1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc([C@@H](C)Oc2cc(Br)cnc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H10BrN3O3S/c1-6(9-5-19-7(2)14-9)18-10-3-8(12)4-13-11(10)15(16)17/h3-6H,1-2H3/t6-/m1/s1 |
| InChIKey | DUXYOYWDRSCSJQ-ZCFIWIBFSA-N |
| XLogP | 3.66 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|