C10H8BrN3O3S — CID 170429147
5-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-1,2-thiazole (PubChem CID 170429147) has the molecular formula C10H8BrN3O3S and a molecular weight of 330.16 g/mol. Its IUPAC name is 5-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-1,2-thiazole.
| Compound Name | 5-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-1,2-thiazole |
|---|---|
| PubChem CID | 170429147 |
| Molecular Formula | C10H8BrN3O3S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 5-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-1,2-thiazole |
| SMILES | CC(Oc1cc(Br)cnc1[N+](=O)[O-])c1ccns1 |
| InChI | InChI=1S/C10H8BrN3O3S/c1-6(9-2-3-13-18-9)17-8-4-7(11)5-12-10(8)14(15)16/h2-6H,1H3 |
| InChIKey | VMASYSBIVRKZRJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|