C11H15BN4O3 — CID 164859066
[6-amino-5-[1-(2-methylpyrazol-3-yl)ethoxy]-3-pyridinyl]boronic acid (PubChem CID 164859066) has the molecular formula C11H15BN4O3 and a molecular weight of 262.08 g/mol. Its IUPAC name is [6-amino-5-[1-(2-methylpyrazol-3-yl)ethoxy]-3-pyridinyl]boronic acid.
| Compound Name | [6-amino-5-[1-(2-methylpyrazol-3-yl)ethoxy]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 164859066 |
| Molecular Formula | C11H15BN4O3 |
| Molecular Weight | 262.08 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [6-amino-5-[1-(2-methylpyrazol-3-yl)ethoxy]-3-pyridinyl]boronic acid |
| SMILES | CC(Oc1cc(B(O)O)cnc1N)c1ccnn1C |
| InChI | InChI=1S/C11H15BN4O3/c1-7(9-3-4-15-16(9)2)19-10-5-8(12(17)18)6-14-11(10)13/h3-7,17-18H,1-2H3,(H2,13,14) |
| InChIKey | ZRFCAIYRVNJKDU-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.08 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|