C7H9BN4O2 — CID 171809825
(3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid (PubChem CID 171809825) has the molecular formula C7H9BN4O2 and a molecular weight of 191.99 g/mol. Its IUPAC name is (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid.
| Compound Name | (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid |
|---|---|
| PubChem CID | 171809825 |
| Molecular Formula | C7H9BN4O2 |
| Molecular Weight | 191.99 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid |
| SMILES | Cn1nc(N)c2ncc(B(O)O)cc21 |
| InChI | InChI=1S/C7H9BN4O2/c1-12-5-2-4(8(13)14)3-10-6(5)7(9)11-12/h2-3,13-14H,1H3,(H2,9,11) |
| InChIKey | JIPWTIQHAWQRED-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.99 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|