(3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid

C7H9BN4O2 — CID 171809825

IUPAC(3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid
SMILESCn1nc(N)c2ncc(B(O)O)cc21
InChIInChI=1S/C7H9BN4O2/c1-12-5-2-4(8(13)14)3-10-6(5)7(9)11-12/h2-3,13-14H,1H3,(H2,9,11)
InChIKeyJIPWTIQHAWQRED-UHFFFAOYSA-N
MW191.99 g/mol
LogP-1.77
Rot. Bonds1

About (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid

(3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid (PubChem CID 171809825) has the molecular formula C7H9BN4O2 and a molecular weight of 191.99 g/mol. Its IUPAC name is (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid.

Molecular Properties

Compound Name(3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid
PubChem CID171809825
Molecular FormulaC7H9BN4O2
Molecular Weight191.99 g/mol
Exact Mass192.08
IUPAC Name(3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid
SMILESCn1nc(N)c2ncc(B(O)O)cc21
InChIInChI=1S/C7H9BN4O2/c1-12-5-2-4(8(13)14)3-10-6(5)7(9)11-12/h2-3,13-14H,1H3,(H2,9,11)
InChIKeyJIPWTIQHAWQRED-UHFFFAOYSA-N
XLogP-1.77
TPSA97.19 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.99
LogP ≤ 5-1.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid?
The IUPAC name of (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid (CID 171809825) is (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid.
What is the SMILES notation for (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid?
The canonical SMILES for (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid is Cn1nc(N)c2ncc(B(O)O)cc21.
What is the InChIKey of (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid?
The InChIKey is JIPWTIQHAWQRED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BN4O2/c1-12-5-2-4(8(13)14)3-10-6(5)7(9)11-12/h2-3,13-14H,1H3,(H2,9,11).
What are the key properties of (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid?
(3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid has a molecular weight of 191.99 g/mol, XLogP of -1.77, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-1-methylpyrazolo[4,3-b]pyridin-6-yl)boronic acid is sourced from PubChem (CID 171809825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).