C18H17F6N3O5S — CID 164862517
N-[(1S)-2-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]ethyl]-3-nitro-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 164862517) has the molecular formula C18H17F6N3O5S and a molecular weight of 501.41 g/mol. Its IUPAC name is N-[(1S)-2-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]ethyl]-3-nitro-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(1S)-2-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]ethyl]-3-nitro-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 164862517 |
| Molecular Formula | C18H17F6N3O5S |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | N-[(1S)-2-(dimethylamino)-1-[3-(trifluoromethyl)phenyl]ethyl]-3-nitro-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CN(C)C[C@@H](NS(=O)(=O)c1ccc(OC(F)(F)F)c([N+](=O)[O-])c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F6N3O5S/c1-26(2)10-14(11-4-3-5-12(8-11)17(19,20)21)25-33(30,31)13-6-7-16(32-18(22,23)24)15(9-13)27(28)29/h3-9,14,25H,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | MNDGJVKUMSDFEC-CQSZACIVSA-N |
| XLogP | 4.09 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|