C17H16Cl2F3N3O5S — CID 164862145
N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-2-nitro-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 164862145) has the molecular formula C17H16Cl2F3N3O5S and a molecular weight of 502.30 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-2-nitro-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-2-nitro-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 164862145 |
| Molecular Formula | C17H16Cl2F3N3O5S |
| Molecular Weight | 502.30 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-2-nitro-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CN(C)C[C@H](NS(=O)(=O)c1cccc(OC(F)(F)F)c1[N+](=O)[O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2F3N3O5S/c1-24(2)9-13(10-6-7-11(18)12(19)8-10)23-31(28,29)15-5-3-4-14(16(15)25(26)27)30-17(20,21)22/h3-8,13,23H,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | FAFXFRRTDQWNPC-ZDUSSCGKSA-N |
| XLogP | 4.38 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|