C21H28Cl2N2O2S — CID 164862329
N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-4-pentylbenzenesulfonamide (PubChem CID 164862329) has the molecular formula C21H28Cl2N2O2S and a molecular weight of 443.44 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 164862329 |
| Molecular Formula | C21H28Cl2N2O2S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)N[C@@H](CN(C)C)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H28Cl2N2O2S/c1-4-5-6-7-16-8-11-18(12-9-16)28(26,27)24-21(15-25(2)3)17-10-13-19(22)20(23)14-17/h8-14,21,24H,4-7,15H2,1-3H3/t21-/m0/s1 |
| InChIKey | QBIMHWDJWRRBMY-NRFANRHFSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|