C20H26Cl2N2O2S — CID 171593382
N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide (PubChem CID 171593382) has the molecular formula C20H26Cl2N2O2S and a molecular weight of 429.41 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171593382 |
| Molecular Formula | C20H26Cl2N2O2S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide |
| SMILES | CCCCCN(C)CC(NS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H26Cl2N2O2S/c1-3-4-8-13-24(2)15-20(16-11-12-18(21)19(22)14-16)23-27(25,26)17-9-6-5-7-10-17/h5-7,9-12,14,20,23H,3-4,8,13,15H2,1-2H3 |
| InChIKey | GOHMOBONHSLDQQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|