About N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide
N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide (PubChem CID 171593382) has the molecular formula C20H26Cl2N2O2S
and a molecular weight of 429.41 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide |
| PubChem CID | 171593382 |
| Molecular Formula | C20H26Cl2N2O2S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide |
| SMILES | CCCCCN(C)CC(NS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H26Cl2N2O2S/c1-3-4-8-13-24(2)15-20(16-11-12-18(21)19(22)14-16)23-27(25,26)17-9-6-5-7-10-17/h5-7,9-12,14,20,23H,3-4,8,13,15H2,1-2H3 |
| InChIKey | GOHMOBONHSLDQQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide?
The IUPAC name of N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide (CID 171593382) is N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide.
What is the SMILES notation for N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide?
The canonical SMILES for N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide is CCCCCN(C)CC(NS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide?
The InChIKey is GOHMOBONHSLDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26Cl2N2O2S/c1-3-4-8-13-24(2)15-20(16-11-12-18(21)19(22)14-16)23-27(25,26)17-9-6-5-7-10-17/h5-7,9-12,14,20,23H,3-4,8,13,15H2,1-2H3.
What are the key properties of N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide?
N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide has a molecular weight of 429.41 g/mol, XLogP of 5.14, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dichlorophenyl)-2-[methyl(pentyl)amino]ethyl]benzenesulfonamide is sourced from PubChem (CID 171593382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).