C23H23Cl2N3O3S — CID 164861878
4-[[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]sulfamoyl]-N-phenylbenzamide (PubChem CID 164861878) has the molecular formula C23H23Cl2N3O3S and a molecular weight of 492.43 g/mol. Its IUPAC name is 4-[[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]sulfamoyl]-N-phenylbenzamide.
| Compound Name | 4-[[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]sulfamoyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 164861878 |
| Molecular Formula | C23H23Cl2N3O3S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 4-[[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]sulfamoyl]-N-phenylbenzamide |
| SMILES | CN(C)CC(NS(=O)(=O)c1ccc(C(=O)Nc2ccccc2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H23Cl2N3O3S/c1-28(2)15-22(17-10-13-20(24)21(25)14-17)27-32(30,31)19-11-8-16(9-12-19)23(29)26-18-6-4-3-5-7-18/h3-14,22,27H,15H2,1-2H3,(H,26,29) |
| InChIKey | SZMNYNMFVMBQPU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |