C17H16Cl2F3N3O4S — CID 164862022
N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-3-nitro-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 164862022) has the molecular formula C17H16Cl2F3N3O4S and a molecular weight of 486.30 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-3-nitro-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-3-nitro-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 164862022 |
| Molecular Formula | C17H16Cl2F3N3O4S |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | N-[(1R)-1-(3,4-dichlorophenyl)-2-(dimethylamino)ethyl]-3-nitro-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C)C[C@H](NS(=O)(=O)c1ccc(C(F)(F)F)c([N+](=O)[O-])c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2F3N3O4S/c1-24(2)9-15(10-3-6-13(18)14(19)7-10)23-30(28,29)11-4-5-12(17(20,21)22)16(8-11)25(26)27/h3-8,15,23H,9H2,1-2H3/t15-/m0/s1 |
| InChIKey | QFAHSBDKITUJKC-HNNXBMFYSA-N |
| XLogP | 4.50 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|