C20H14F4N8O — CID 164863015
N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 164863015) has the molecular formula C20H14F4N8O and a molecular weight of 458.38 g/mol. Its IUPAC name is N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164863015 |
| Molecular Formula | C20H14F4N8O |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[5-cyano-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-1-[(3-fluorophenyl)methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | [H]/N=C/C=N\Nc1ncc(NC(=O)c2cnn(Cc3cccc(F)c3)c2C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C20H14F4N8O/c21-14-3-1-2-12(6-14)11-32-17(20(22,23)24)16(10-29-32)19(33)30-15-7-13(8-26)18(27-9-15)31-28-5-4-25/h1-7,9-10,25H,11H2,(H,27,31)(H,30,33)/b25-4+,28-5- |
| InChIKey | MMGFDXAQTUOMHN-TZXKBVJYSA-N |
| XLogP | 3.66 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|