C22H18Cl2F2N6O2 — CID 167302310
2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-hydroxyethylamino)phenyl]benzamide (PubChem CID 167302310) has the molecular formula C22H18Cl2F2N6O2 and a molecular weight of 507.33 g/mol. Its IUPAC name is 2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-hydroxyethylamino)phenyl]benzamide.
| Compound Name | 2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-hydroxyethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 167302310 |
| Molecular Formula | C22H18Cl2F2N6O2 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-hydroxyethylamino)phenyl]benzamide |
| SMILES | [H]/N=C/C=N\Nc1ncc(NC(=O)c2cc(F)c(-c3ccc(F)cc3NCCO)cc2Cl)cc1Cl |
| InChI | InChI=1S/C22H18Cl2F2N6O2/c23-17-9-15(14-2-1-12(25)7-20(14)28-5-6-33)19(26)10-16(17)22(34)31-13-8-18(24)21(29-11-13)32-30-4-3-27/h1-4,7-11,27-28,33H,5-6H2,(H,29,32)(H,31,34)/b27-3+,30-4- |
| InChIKey | UUSWNYBYOXOJSV-NCLLHGFTSA-N |
| XLogP | 5.04 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|