C23H20Cl2F2N6O2 — CID 167302611
2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-methoxyethylamino)phenyl]benzamide (PubChem CID 167302611) has the molecular formula C23H20Cl2F2N6O2 and a molecular weight of 521.36 g/mol. Its IUPAC name is 2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-methoxyethylamino)phenyl]benzamide.
| Compound Name | 2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-methoxyethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 167302611 |
| Molecular Formula | C23H20Cl2F2N6O2 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluoro-4-[4-fluoro-2-(2-methoxyethylamino)phenyl]benzamide |
| SMILES | [H]/N=C/C=N\Nc1ncc(NC(=O)c2cc(F)c(-c3ccc(F)cc3NCCOC)cc2Cl)cc1Cl |
| InChI | InChI=1S/C23H20Cl2F2N6O2/c1-35-7-6-29-21-8-13(26)2-3-15(21)16-10-18(24)17(11-20(16)27)23(34)32-14-9-19(25)22(30-12-14)33-31-5-4-28/h2-5,8-12,28-29H,6-7H2,1H3,(H,30,33)(H,32,34)/b28-4+,31-5- |
| InChIKey | ILACVFOMTKVIRD-RMMZPYBPSA-N |
| XLogP | 5.69 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|