C20H12Cl2F2N6O2 — CID 166463109
5-[[4-(2-amino-6-fluoro-3-pyridinyl)-2-chloro-5-fluorobenzoyl]amino]-3-chloro-N-(cyanomethyl)pyridine-2-carboxamide (PubChem CID 166463109) has the molecular formula C20H12Cl2F2N6O2 and a molecular weight of 477.26 g/mol. Its IUPAC name is 5-[[4-(2-amino-6-fluoro-3-pyridinyl)-2-chloro-5-fluorobenzoyl]amino]-3-chloro-N-(cyanomethyl)pyridine-2-carboxamide.
| Compound Name | 5-[[4-(2-amino-6-fluoro-3-pyridinyl)-2-chloro-5-fluorobenzoyl]amino]-3-chloro-N-(cyanomethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166463109 |
| Molecular Formula | C20H12Cl2F2N6O2 |
| Molecular Weight | 477.26 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 5-[[4-(2-amino-6-fluoro-3-pyridinyl)-2-chloro-5-fluorobenzoyl]amino]-3-chloro-N-(cyanomethyl)pyridine-2-carboxamide |
| SMILES | N#CCNC(=O)c1ncc(NC(=O)c2cc(F)c(-c3ccc(F)nc3N)cc2Cl)cc1Cl |
| InChI | InChI=1S/C20H12Cl2F2N6O2/c21-13-6-11(10-1-2-16(24)30-18(10)26)15(23)7-12(13)19(31)29-9-5-14(22)17(28-8-9)20(32)27-4-3-25/h1-2,5-8H,4H2,(H2,26,30)(H,27,32)(H,29,31) |
| InChIKey | RHQRYCOXFAEIQU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|