C20H14Cl2F2N6O — CID 167302619
4-(2-amino-4-fluorophenyl)-2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluorobenzamide (PubChem CID 167302619) has the molecular formula C20H14Cl2F2N6O and a molecular weight of 463.28 g/mol. Its IUPAC name is 4-(2-amino-4-fluorophenyl)-2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluorobenzamide.
| Compound Name | 4-(2-amino-4-fluorophenyl)-2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 167302619 |
| Molecular Formula | C20H14Cl2F2N6O |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 4-(2-amino-4-fluorophenyl)-2-chloro-N-[5-chloro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-3-pyridinyl]-5-fluorobenzamide |
| SMILES | [H]/N=C/C=N\Nc1ncc(NC(=O)c2cc(F)c(-c3ccc(F)cc3N)cc2Cl)cc1Cl |
| InChI | InChI=1S/C20H14Cl2F2N6O/c21-15-7-13(12-2-1-10(23)5-18(12)26)17(24)8-14(15)20(31)29-11-6-16(22)19(27-9-11)30-28-4-3-25/h1-9,25H,26H2,(H,27,30)(H,29,31)/b25-3+,28-4- |
| InChIKey | FBOZORMBBZNSRQ-QYWSBZOGSA-N |
| XLogP | 5.22 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|