C20H19N5O5S2 — CID 164863806
N-(3-cyano-4-methyl-1H-indol-7-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide (PubChem CID 164863806) has the molecular formula C20H19N5O5S2 and a molecular weight of 473.54 g/mol. Its IUPAC name is N-(3-cyano-4-methyl-1H-indol-7-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide.
| Compound Name | N-(3-cyano-4-methyl-1H-indol-7-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 164863806 |
| Molecular Formula | C20H19N5O5S2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-(3-cyano-4-methyl-1H-indol-7-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(S(=O)(=O)N3CCNC(=O)C3)cc2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C20H19N5O5S2/c1-13-2-7-17(20-19(13)14(10-21)11-23-20)24-31(27,28)15-3-5-16(6-4-15)32(29,30)25-9-8-22-18(26)12-25/h2-7,11,23-24H,8-9,12H2,1H3,(H,22,26) |
| InChIKey | BDLNBWLJFVWFLG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |