C16H17FN4O — CID 164865767
acetylene;6-ethyl-5-fluoro-N-(furan-2-ylmethyl)-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 164865767) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is acetylene;6-ethyl-5-fluoro-N-(furan-2-ylmethyl)-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | acetylene;6-ethyl-5-fluoro-N-(furan-2-ylmethyl)-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164865767 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | acetylene;6-ethyl-5-fluoro-N-(furan-2-ylmethyl)-2-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C#C.CCc1[nH]c2nc(C)nc(NCc3ccco3)c2c1F |
| InChI | InChI=1S/C14H15FN4O.C2H2/c1-3-10-12(15)11-13(16-7-9-5-4-6-20-9)17-8(2)18-14(11)19-10;1-2/h4-6H,3,7H2,1-2H3,(H2,16,17,18,19);1-2H |
| InChIKey | MFDHMQCPWJMIEW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|