C15H20FN3O3 — CID 164867777
5-fluoro-N-hydroxy-2-(morpholin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 164867777) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is 5-fluoro-N-hydroxy-2-(morpholin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | 5-fluoro-N-hydroxy-2-(morpholin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 164867777 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-fluoro-N-hydroxy-2-(morpholin-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | O=C(NO)c1cc(F)c2c(c1)CN(CC1CNCCO1)CC2 |
| InChI | InChI=1S/C15H20FN3O3/c16-14-6-10(15(20)18-21)5-11-8-19(3-1-13(11)14)9-12-7-17-2-4-22-12/h5-6,12,17,21H,1-4,7-9H2,(H,18,20) |
| InChIKey | JNSCCBKDOCCHQX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|