C19H30FN3O2 — CID 164867967
2-[(1,2-dimethylpyrrolidin-2-yl)methyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane (PubChem CID 164867967) has the molecular formula C19H30FN3O2 and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-[(1,2-dimethylpyrrolidin-2-yl)methyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane.
| Compound Name | 2-[(1,2-dimethylpyrrolidin-2-yl)methyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane |
|---|---|
| PubChem CID | 164867967 |
| Molecular Formula | C19H30FN3O2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-[(1,2-dimethylpyrrolidin-2-yl)methyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane |
| SMILES | CC.CN1CCCC1(C)CN1CCc2c(F)cc(C(=O)NO)cc2C1 |
| InChI | InChI=1S/C17H24FN3O2.C2H6/c1-17(5-3-6-20(17)2)11-21-7-4-14-13(10-21)8-12(9-15(14)18)16(22)19-23;1-2/h8-9,23H,3-7,10-11H2,1-2H3,(H,19,22);1-2H3 |
| InChIKey | IRPHJWPSOQCKMK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|