C22H31FN2O2 — CID 155598384
2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 155598384) has the molecular formula C22H31FN2O2 and a molecular weight of 374.50 g/mol. Its IUPAC name is 2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 155598384 |
| Molecular Formula | C22H31FN2O2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methyl]-8-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | CC1CC2CC(C1)CC(C)(CN1CCc3cc(C(=O)NO)cc(F)c3C1)C2 |
| InChI | InChI=1S/C22H31FN2O2/c1-14-5-15-7-16(6-14)11-22(2,10-15)13-25-4-3-17-8-18(21(26)24-27)9-20(23)19(17)12-25/h8-9,14-16,27H,3-7,10-13H2,1-2H3,(H,24,26) |
| InChIKey | MZJSITVGVHIWMG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|