C20H30FN3O2 — CID 164868837
ethane;5-fluoro-N-hydroxy-2-[(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 164868837) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is ethane;5-fluoro-N-hydroxy-2-[(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | ethane;5-fluoro-N-hydroxy-2-[(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 164868837 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | ethane;5-fluoro-N-hydroxy-2-[(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | CC.CN1CC2CC(C1)C2CN1CCc2c(F)cc(C(=O)NO)cc2C1 |
| InChI | InChI=1S/C18H24FN3O2.C2H6/c1-21-7-12-5-13(8-21)16(12)10-22-3-2-15-14(9-22)4-11(6-17(15)19)18(23)20-24;1-2/h4,6,12-13,16,24H,2-3,5,7-10H2,1H3,(H,20,23);1-2H3 |
| InChIKey | YKLRSMDSIHBBFU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|