C20H32FN3O2 — CID 164867745
2-[3-(1,3-dimethylazetidin-3-yl)propyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane (PubChem CID 164867745) has the molecular formula C20H32FN3O2 and a molecular weight of 365.49 g/mol. Its IUPAC name is 2-[3-(1,3-dimethylazetidin-3-yl)propyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane.
| Compound Name | 2-[3-(1,3-dimethylazetidin-3-yl)propyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane |
|---|---|
| PubChem CID | 164867745 |
| Molecular Formula | C20H32FN3O2 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 2-[3-(1,3-dimethylazetidin-3-yl)propyl]-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide;ethane |
| SMILES | CC.CN1CC(C)(CCCN2CCc3c(F)cc(C(=O)NO)cc3C2)C1 |
| InChI | InChI=1S/C18H26FN3O2.C2H6/c1-18(11-21(2)12-18)5-3-6-22-7-4-15-14(10-22)8-13(9-16(15)19)17(23)20-24;1-2/h8-9,24H,3-7,10-12H2,1-2H3,(H,20,23);1-2H3 |
| InChIKey | TZWFOUGPPCOVOT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|