C21H28FN3O3 — CID 164868430
(3R)-3-ethyl-5-fluoro-N-hydroxy-2-[(2-methyl-3-oxo-2-azabicyclo[2.2.2]octan-1-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 164868430) has the molecular formula C21H28FN3O3 and a molecular weight of 389.47 g/mol. Its IUPAC name is (3R)-3-ethyl-5-fluoro-N-hydroxy-2-[(2-methyl-3-oxo-2-azabicyclo[2.2.2]octan-1-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | (3R)-3-ethyl-5-fluoro-N-hydroxy-2-[(2-methyl-3-oxo-2-azabicyclo[2.2.2]octan-1-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 164868430 |
| Molecular Formula | C21H28FN3O3 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (3R)-3-ethyl-5-fluoro-N-hydroxy-2-[(2-methyl-3-oxo-2-azabicyclo[2.2.2]octan-1-yl)methyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | CC[C@@H]1Cc2c(F)cc(C(=O)NO)cc2CN1CC12CCC(CC1)C(=O)N2C |
| InChI | InChI=1S/C21H28FN3O3/c1-3-16-10-17-15(8-14(9-18(17)22)19(26)23-28)11-25(16)12-21-6-4-13(5-7-21)20(27)24(21)2/h8-9,13,16,28H,3-7,10-12H2,1-2H3,(H,23,26)/t13?,16-,21?/m1/s1 |
| InChIKey | AREFYAKUQMVJRF-PCIUKOCSSA-N |
| XLogP | 2.48 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|