C18H30FN3O2 — CID 164868845
8-fluoro-N-hydroxy-2-[3-[3-(methylamino)propyl]cyclobutyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;molecular hydrogen (PubChem CID 164868845) has the molecular formula C18H30FN3O2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 8-fluoro-N-hydroxy-2-[3-[3-(methylamino)propyl]cyclobutyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;molecular hydrogen.
| Compound Name | 8-fluoro-N-hydroxy-2-[3-[3-(methylamino)propyl]cyclobutyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 164868845 |
| Molecular Formula | C18H30FN3O2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 8-fluoro-N-hydroxy-2-[3-[3-(methylamino)propyl]cyclobutyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;molecular hydrogen |
| SMILES | CNCCCC1CC(N2CCc3cc(C(=O)NO)cc(F)c3C2)C1.[H][H].[H][H] |
| InChI | InChI=1S/C18H26FN3O2.2H2/c1-20-5-2-3-12-7-15(8-12)22-6-4-13-9-14(18(23)21-24)10-17(19)16(13)11-22;;/h9-10,12,15,20,24H,2-8,11H2,1H3,(H,21,23);2*1H |
| InChIKey | XMVLESOMWXKIBN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|