C16H30N4O2 — CID 169125895
7-[3-(3-aminopropyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide;molecular hydrogen (PubChem CID 169125895) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 7-[3-(3-aminopropyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide;molecular hydrogen.
| Compound Name | 7-[3-(3-aminopropyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 169125895 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 7-[3-(3-aminopropyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide;molecular hydrogen |
| SMILES | NCCCC1CC(N2CCc3cc(C(=O)NO)cnc3C2)C1.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C16H24N4O2.3H2/c17-4-1-2-11-6-14(7-11)20-5-3-12-8-13(16(21)19-22)9-18-15(12)10-20;;;/h8-9,11,14,22H,1-7,10,17H2,(H,19,21);3*1H |
| InChIKey | SXHAGWURNSHMCC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|