C18H24F2N4O2 — CID 169125654
7-[5-(difluoromethyl)-5-azaspiro[3.5]nonan-2-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide (PubChem CID 169125654) has the molecular formula C18H24F2N4O2 and a molecular weight of 366.41 g/mol. Its IUPAC name is 7-[5-(difluoromethyl)-5-azaspiro[3.5]nonan-2-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide.
| Compound Name | 7-[5-(difluoromethyl)-5-azaspiro[3.5]nonan-2-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169125654 |
| Molecular Formula | C18H24F2N4O2 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 7-[5-(difluoromethyl)-5-azaspiro[3.5]nonan-2-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
| SMILES | O=C(NO)c1cnc2c(c1)CCN(C1CC3(CCCCN3C(F)F)C1)C2 |
| InChI | InChI=1S/C18H24F2N4O2/c19-17(20)24-5-2-1-4-18(24)8-14(9-18)23-6-3-12-7-13(16(25)22-26)10-21-15(12)11-23/h7,10,14,17,26H,1-6,8-9,11H2,(H,22,25) |
| InChIKey | URDFDFRFCMGTCE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|