C17H24N4O2 — CID 176769078
N-hydroxy-7-[(3R,4R)-5-methyl-5-azaspiro[3.4]octan-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide (PubChem CID 176769078) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-hydroxy-7-[(3R,4R)-5-methyl-5-azaspiro[3.4]octan-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide.
| Compound Name | N-hydroxy-7-[(3R,4R)-5-methyl-5-azaspiro[3.4]octan-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 176769078 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-hydroxy-7-[(3R,4R)-5-methyl-5-azaspiro[3.4]octan-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
| SMILES | CN1CCC[C@]12CC[C@H]2N1CCc2cc(C(=O)NO)cnc2C1 |
| InChI | InChI=1S/C17H24N4O2/c1-20-7-2-5-17(20)6-3-15(17)21-8-4-12-9-13(16(22)19-23)10-18-14(12)11-21/h9-10,15,23H,2-8,11H2,1H3,(H,19,22)/t15-,17-/m1/s1 |
| InChIKey | XATNBDXPZBQZHC-NVXWUHKLSA-N |
| XLogP | 1.19 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|