C19H26N4O3 — CID 169125246
7-[(3R,4R)-5-acetyl-5-azaspiro[3.5]nonan-3-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide (PubChem CID 169125246) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 7-[(3R,4R)-5-acetyl-5-azaspiro[3.5]nonan-3-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide.
| Compound Name | 7-[(3R,4R)-5-acetyl-5-azaspiro[3.5]nonan-3-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169125246 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 7-[(3R,4R)-5-acetyl-5-azaspiro[3.5]nonan-3-yl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
| SMILES | CC(=O)N1CCCC[C@]12CC[C@H]2N1CCc2cc(C(=O)NO)cnc2C1 |
| InChI | InChI=1S/C19H26N4O3/c1-13(24)23-8-3-2-6-19(23)7-4-17(19)22-9-5-14-10-15(18(25)21-26)11-20-16(14)12-22/h10-11,17,26H,2-9,12H2,1H3,(H,21,25)/t17-,19-/m1/s1 |
| InChIKey | PXEGVBJNZCDCDV-IEBWSBKVSA-N |
| XLogP | 1.49 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|