C20H29N3O2 — CID 169125578
N-hydroxy-7-(spiro[4.5]decan-3-ylmethyl)-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide (PubChem CID 169125578) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-hydroxy-7-(spiro[4.5]decan-3-ylmethyl)-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide.
| Compound Name | N-hydroxy-7-(spiro[4.5]decan-3-ylmethyl)-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169125578 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-hydroxy-7-(spiro[4.5]decan-3-ylmethyl)-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
| SMILES | O=C(NO)c1cnc2c(c1)CCN(CC1CCC3(CCCCC3)C1)C2 |
| InChI | InChI=1S/C20H29N3O2/c24-19(22-25)17-10-16-5-9-23(14-18(16)21-12-17)13-15-4-8-20(11-15)6-2-1-3-7-20/h10,12,15,25H,1-9,11,13-14H2,(H,22,24) |
| InChIKey | LXWWTGNIJFATLP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|