C21H30N4O2 — CID 169125084
7-[(7-cyclopropyl-7-azaspiro[3.5]nonan-2-yl)methyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide (PubChem CID 169125084) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 7-[(7-cyclopropyl-7-azaspiro[3.5]nonan-2-yl)methyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide.
| Compound Name | 7-[(7-cyclopropyl-7-azaspiro[3.5]nonan-2-yl)methyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169125084 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 7-[(7-cyclopropyl-7-azaspiro[3.5]nonan-2-yl)methyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
| SMILES | O=C(NO)c1cnc2c(c1)CCN(CC1CC3(CCN(C4CC4)CC3)C1)C2 |
| InChI | InChI=1S/C21H30N4O2/c26-20(23-27)17-9-16-3-6-24(14-19(16)22-12-17)13-15-10-21(11-15)4-7-25(8-5-21)18-1-2-18/h9,12,15,18,27H,1-8,10-11,13-14H2,(H,23,26) |
| InChIKey | CVRPHXNSDUEXHJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|