C12H27NOS — CID 164871229
N-(3-ethylhex-5-en-3-yl)-2-methylpropane-2-sulfinamide;molecular hydrogen (PubChem CID 164871229) has the molecular formula C12H27NOS and a molecular weight of 233.42 g/mol. Its IUPAC name is N-(3-ethylhex-5-en-3-yl)-2-methylpropane-2-sulfinamide;molecular hydrogen.
| Compound Name | N-(3-ethylhex-5-en-3-yl)-2-methylpropane-2-sulfinamide;molecular hydrogen |
|---|---|
| PubChem CID | 164871229 |
| Molecular Formula | C12H27NOS |
| Molecular Weight | 233.42 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-(3-ethylhex-5-en-3-yl)-2-methylpropane-2-sulfinamide;molecular hydrogen |
| SMILES | C=CCC(CC)(CC)NS(=O)C(C)(C)C.[H][H] |
| InChI | InChI=1S/C12H25NOS.H2/c1-7-10-12(8-2,9-3)13-15(14)11(4,5)6;/h7,13H,1,8-10H2,2-6H3;1H |
| InChIKey | FGMGLOUMGPFTFE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|