C13H27NOS — CID 146474161
(R)-2-methyl-N-[(4R)-4-methyloct-1-en-4-yl]propane-2-sulfinamide (PubChem CID 146474161) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is (R)-2-methyl-N-[(4R)-4-methyloct-1-en-4-yl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(4R)-4-methyloct-1-en-4-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 146474161 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (R)-2-methyl-N-[(4R)-4-methyloct-1-en-4-yl]propane-2-sulfinamide |
| SMILES | C=CC[C@@](C)(CCCC)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NOS/c1-7-9-11-13(6,10-8-2)14-16(15)12(3,4)5/h8,14H,2,7,9-11H2,1,3-6H3/t13-,16+/m0/s1 |
| InChIKey | UNDGQDNETBXNSU-XJKSGUPXSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|