C13H27NOS — CID 134965670
(S)-N-[(4R)-4,6-dimethylhept-1-en-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 134965670) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is (S)-N-[(4R)-4,6-dimethylhept-1-en-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(4R)-4,6-dimethylhept-1-en-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134965670 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (S)-N-[(4R)-4,6-dimethylhept-1-en-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@@](C)(CC(C)C)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NOS/c1-8-9-13(7,10-11(2)3)14-16(15)12(4,5)6/h8,11,14H,1,9-10H2,2-7H3/t13-,16-/m0/s1 |
| InChIKey | NACALVBGXUEQGX-BBRMVZONSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|