C12H23NOS — CID 170428853
2-methyl-N-(1-prop-2-enylcyclopentyl)propane-2-sulfinamide (PubChem CID 170428853) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is 2-methyl-N-(1-prop-2-enylcyclopentyl)propane-2-sulfinamide.
| Compound Name | 2-methyl-N-(1-prop-2-enylcyclopentyl)propane-2-sulfinamide |
|---|---|
| PubChem CID | 170428853 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 2-methyl-N-(1-prop-2-enylcyclopentyl)propane-2-sulfinamide |
| SMILES | C=CCC1(NS(=O)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C12H23NOS/c1-5-8-12(9-6-7-10-12)13-15(14)11(2,3)4/h5,13H,1,6-10H2,2-4H3 |
| InChIKey | QENPFIROVUOSGM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|