C26H30F2N4O3 — CID 164873054
1-[3-amino-5-[(1R)-1-[[7-ethynyl-6-(2-methoxyethoxy)-2-methylquinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol (PubChem CID 164873054) has the molecular formula C26H30F2N4O3 and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-[3-amino-5-[(1R)-1-[[7-ethynyl-6-(2-methoxyethoxy)-2-methylquinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol.
| Compound Name | 1-[3-amino-5-[(1R)-1-[[7-ethynyl-6-(2-methoxyethoxy)-2-methylquinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 164873054 |
| Molecular Formula | C26H30F2N4O3 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 1-[3-amino-5-[(1R)-1-[[7-ethynyl-6-(2-methoxyethoxy)-2-methylquinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol |
| SMILES | C#Cc1cc2nc(C)nc(N[C@H](C)c3cc(N)cc(C(F)(F)C(C)(C)O)c3)c2cc1OCCOC |
| InChI | InChI=1S/C26H30F2N4O3/c1-7-17-12-22-21(14-23(17)35-9-8-34-6)24(32-16(3)31-22)30-15(2)18-10-19(13-20(29)11-18)26(27,28)25(4,5)33/h1,10-15,33H,8-9,29H2,2-6H3,(H,30,31,32)/t15-/m1/s1 |
| InChIKey | KMJBSIKHKCXCEA-OAHLLOKOSA-N |
| XLogP | 4.56 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|