C26H31F3N4O4 — CID 170147039
1-[3-amino-5-[(1R)-1-[[7-fluoro-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]quinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol (PubChem CID 170147039) has the molecular formula C26H31F3N4O4 and a molecular weight of 520.55 g/mol. Its IUPAC name is 1-[3-amino-5-[(1R)-1-[[7-fluoro-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]quinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol.
| Compound Name | 1-[3-amino-5-[(1R)-1-[[7-fluoro-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]quinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 170147039 |
| Molecular Formula | C26H31F3N4O4 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 1-[3-amino-5-[(1R)-1-[[7-fluoro-2-methyl-6-[2-(oxetan-3-yloxy)ethoxy]quinazolin-4-yl]amino]ethyl]phenyl]-1,1-difluoro-2-methylpropan-2-ol |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)C(C)(C)O)c2)c2cc(OCCOC3COC3)c(F)cc2n1 |
| InChI | InChI=1S/C26H31F3N4O4/c1-14(16-7-17(9-18(30)8-16)26(28,29)25(3,4)34)31-24-20-10-23(37-6-5-36-19-12-35-13-19)21(27)11-22(20)32-15(2)33-24/h7-11,14,19,34H,5-6,12-13,30H2,1-4H3,(H,31,32,33)/t14-/m1/s1 |
| InChIKey | FWGSEIQZGKAYJE-CQSZACIVSA-N |
| XLogP | 4.49 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|