C19H26N4O2S — CID 164875171
2-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N-(2-propan-2-yloxyethyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 164875171) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N-(2-propan-2-yloxyethyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N-(2-propan-2-yloxyethyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 164875171 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-(3,8-diazabicyclo[3.2.1]octan-8-yl)-N-(2-propan-2-yloxyethyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(C)OCCNC(=O)c1ccc2nc(N3C4CCC3CNC4)sc2c1 |
| InChI | InChI=1S/C19H26N4O2S/c1-12(2)25-8-7-21-18(24)13-3-6-16-17(9-13)26-19(22-16)23-14-4-5-15(23)11-20-10-14/h3,6,9,12,14-15,20H,4-5,7-8,10-11H2,1-2H3,(H,21,24) |
| InChIKey | NNRHTERDAZLDNQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|