About 5,5-dimethyltetrazolo[1,5-a]azepine
5,5-dimethyltetrazolo[1,5-a]azepine (PubChem CID 164876361) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 5,5-dimethyltetrazolo[1,5-a]azepine.
Molecular Properties
| Compound Name | 5,5-dimethyltetrazolo[1,5-a]azepine |
| PubChem CID | 164876361 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5,5-dimethyltetrazolo[1,5-a]azepine |
| SMILES | CC1(C)C=CC=Cc2nnnn21 |
| InChI | InChI=1S/C8H10N4/c1-8(2)6-4-3-5-7-9-10-11-12(7)8/h3-6H,1-2H3 |
| InChIKey | ATBACGADIRTGAO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dimethyltetrazolo[1,5-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyltetrazolo[1,5-a]azepine?
The IUPAC name of 5,5-dimethyltetrazolo[1,5-a]azepine (CID 164876361) is 5,5-dimethyltetrazolo[1,5-a]azepine.
What is the SMILES notation for 5,5-dimethyltetrazolo[1,5-a]azepine?
The canonical SMILES for 5,5-dimethyltetrazolo[1,5-a]azepine is CC1(C)C=CC=Cc2nnnn21.
What is the InChIKey of 5,5-dimethyltetrazolo[1,5-a]azepine?
The InChIKey is ATBACGADIRTGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-8(2)6-4-3-5-7-9-10-11-12(7)8/h3-6H,1-2H3.
What are the key properties of 5,5-dimethyltetrazolo[1,5-a]azepine?
5,5-dimethyltetrazolo[1,5-a]azepine has a molecular weight of 162.20 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyltetrazolo[1,5-a]azepine is sourced from PubChem (CID 164876361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).