potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate

C7H14KNO — CID 164878307

IUPACpotassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate
SMILESCN(C)CC1(C[O-])CC1.[K+]
InChIInChI=1S/C7H14NO.K/c1-8(2)5-7(6-9)3-4-7;/h3-6H2,1-2H3;/q-1;+1
InChIKeyPQXRWCKVGSGZMP-UHFFFAOYSA-N
MW167.29 g/mol
LogP-3.31
Rot. Bonds3

About potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate

potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate (PubChem CID 164878307) has the molecular formula C7H14KNO and a molecular weight of 167.29 g/mol. Its IUPAC name is potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate.

Molecular Properties

Compound Namepotassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate
PubChem CID164878307
Molecular FormulaC7H14KNO
Molecular Weight167.29 g/mol
Exact Mass167.07
IUPAC Namepotassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate
SMILESCN(C)CC1(C[O-])CC1.[K+]
InChIInChI=1S/C7H14NO.K/c1-8(2)5-7(6-9)3-4-7;/h3-6H2,1-2H3;/q-1;+1
InChIKeyPQXRWCKVGSGZMP-UHFFFAOYSA-N
XLogP-3.31
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.29
LogP ≤ 5-3.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate?
The IUPAC name of potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate (CID 164878307) is potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate.
What is the SMILES notation for potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate?
The canonical SMILES for potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate is CN(C)CC1(C[O-])CC1.[K+].
What is the InChIKey of potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate?
The InChIKey is PQXRWCKVGSGZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14NO.K/c1-8(2)5-7(6-9)3-4-7;/h3-6H2,1-2H3;/q-1;+1.
What are the key properties of potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate?
potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate has a molecular weight of 167.29 g/mol, XLogP of -3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [1-[(dimethylamino)methyl]cyclopropyl]methanolate is sourced from PubChem (CID 164878307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).