C7H15NOS — CID 168906707
N,N-dimethyl-1-[1-(sulfanyloxymethyl)cyclopropyl]methanamine (PubChem CID 168906707) has the molecular formula C7H15NOS and a molecular weight of 161.27 g/mol. Its IUPAC name is N,N-dimethyl-1-[1-(sulfanyloxymethyl)cyclopropyl]methanamine.
| Compound Name | N,N-dimethyl-1-[1-(sulfanyloxymethyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 168906707 |
| Molecular Formula | C7H15NOS |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | N,N-dimethyl-1-[1-(sulfanyloxymethyl)cyclopropyl]methanamine |
| SMILES | CN(C)CC1(COS)CC1 |
| InChI | InChI=1S/C7H15NOS/c1-8(2)5-7(3-4-7)6-9-10/h10H,3-6H2,1-2H3 |
| InChIKey | LHXVIYNZBLZZIU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|