C23H36N2 — CID 164879233
2-butyl-1-hexyl-5-(2-methylcyclohexa-1,5-dien-1-yl)-4-prop-1-en-2-ylimidazole (PubChem CID 164879233) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is 2-butyl-1-hexyl-5-(2-methylcyclohexa-1,5-dien-1-yl)-4-prop-1-en-2-ylimidazole.
| Compound Name | 2-butyl-1-hexyl-5-(2-methylcyclohexa-1,5-dien-1-yl)-4-prop-1-en-2-ylimidazole |
|---|---|
| PubChem CID | 164879233 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | 2-butyl-1-hexyl-5-(2-methylcyclohexa-1,5-dien-1-yl)-4-prop-1-en-2-ylimidazole |
| SMILES | C=C(C)c1nc(CCCC)n(CCCCCC)c1C1=C(C)CCC=C1 |
| InChI | InChI=1S/C23H36N2/c1-6-8-10-13-17-25-21(16-9-7-2)24-22(18(3)4)23(25)20-15-12-11-14-19(20)5/h12,15H,3,6-11,13-14,16-17H2,1-2,4-5H3 |
| InChIKey | AVXPPEQOCGHZBS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|