C16H20N2O5 — CID 164881966
[5-ethynyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 164881966) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is [5-ethynyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [5-ethynyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 164881966 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [5-ethynyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | C#CC1(n2cc(C)c(=O)[nH]c2=O)CCC(COC(=O)C(C)C)O1 |
| InChI | InChI=1S/C16H20N2O5/c1-5-16(18-8-11(4)13(19)17-15(18)21)7-6-12(23-16)9-22-14(20)10(2)3/h1,8,10,12H,6-7,9H2,2-4H3,(H,17,19,21) |
| InChIKey | UDRSRUHICNWKCU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|