C14H17BrN2O8 — CID 151827045
[(2R,3S,4R,5S)-3-acetyl-5-bromo-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 151827045) has the molecular formula C14H17BrN2O8 and a molecular weight of 421.20 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3-acetyl-5-bromo-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S)-3-acetyl-5-bromo-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 151827045 |
| Molecular Formula | C14H17BrN2O8 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | [(2R,3S,4R,5S)-3-acetyl-5-bromo-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@](Br)(n2cc(C)c(=O)[nH]c2=O)[C@H](O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C14H17BrN2O8/c1-6-4-17(12(22)16-10(6)20)14(15)11(21)13(23,7(2)18)9(25-14)5-24-8(3)19/h4,9,11,21,23H,5H2,1-3H3,(H,16,20,22)/t9-,11-,13-,14+/m1/s1 |
| InChIKey | SDVNHEXCSOXUSJ-IMJCEVDSSA-N |
| XLogP | -1.51 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|