C25H32O6 — CID 164884937
(1-benzoyloxy-6-ethyl-3,5-dihydroxy-2-methyloctyl) benzoate (PubChem CID 164884937) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is (1-benzoyloxy-6-ethyl-3,5-dihydroxy-2-methyloctyl) benzoate.
| Compound Name | (1-benzoyloxy-6-ethyl-3,5-dihydroxy-2-methyloctyl) benzoate |
|---|---|
| PubChem CID | 164884937 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (1-benzoyloxy-6-ethyl-3,5-dihydroxy-2-methyloctyl) benzoate |
| SMILES | CCC(CC)C(O)CC(O)C(C)C(OC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H32O6/c1-4-18(5-2)22(27)16-21(26)17(3)25(30-23(28)19-12-8-6-9-13-19)31-24(29)20-14-10-7-11-15-20/h6-15,17-18,21-22,25-27H,4-5,16H2,1-3H3 |
| InChIKey | LAQMNVUNVZWDGZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|